C14H13F2N3O2 — CID 171653313
(2R)-2-(2,3-difluoro-5-pyridazin-3-yloxyphenyl)morpholine (PubChem CID 171653313) has the molecular formula C14H13F2N3O2 and a molecular weight of 293.27 g/mol. Its IUPAC name is (2R)-2-(2,3-difluoro-5-pyridazin-3-yloxyphenyl)morpholine.
| Compound Name | (2R)-2-(2,3-difluoro-5-pyridazin-3-yloxyphenyl)morpholine |
|---|---|
| PubChem CID | 171653313 |
| Molecular Formula | C14H13F2N3O2 |
| Molecular Weight | 293.27 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | (2R)-2-(2,3-difluoro-5-pyridazin-3-yloxyphenyl)morpholine |
| SMILES | Fc1cc(Oc2cccnn2)cc([C@@H]2CNCCO2)c1F |
| InChI | InChI=1S/C14H13F2N3O2/c15-11-7-9(21-13-2-1-3-18-19-13)6-10(14(11)16)12-8-17-4-5-20-12/h1-3,6-7,12,17H,4-5,8H2/t12-/m0/s1 |
| InChIKey | HMYVWFLLOKTFLQ-LBPRGKRZSA-N |
| XLogP | 2.21 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.27 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |