C21H30ClN5O3 — CID 171660576
5-chloro-4-[5-(3-pyrrolidin-1-ylpropoxy)-3-pyridinyl]pyrimidin-2-amine;oxan-3-ol (PubChem CID 171660576) has the molecular formula C21H30ClN5O3 and a molecular weight of 435.96 g/mol. Its IUPAC name is 5-chloro-4-[5-(3-pyrrolidin-1-ylpropoxy)-3-pyridinyl]pyrimidin-2-amine;oxan-3-ol.
| Compound Name | 5-chloro-4-[5-(3-pyrrolidin-1-ylpropoxy)-3-pyridinyl]pyrimidin-2-amine;oxan-3-ol |
|---|---|
| PubChem CID | 171660576 |
| Molecular Formula | C21H30ClN5O3 |
| Molecular Weight | 435.96 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | 5-chloro-4-[5-(3-pyrrolidin-1-ylpropoxy)-3-pyridinyl]pyrimidin-2-amine;oxan-3-ol |
| SMILES | Nc1ncc(Cl)c(-c2cncc(OCCCN3CCCC3)c2)n1.OC1CCCOC1 |
| InChI | InChI=1S/C16H20ClN5O.C5H10O2/c17-14-11-20-16(18)21-15(14)12-8-13(10-19-9-12)23-7-3-6-22-4-1-2-5-22;6-5-2-1-3-7-4-5/h8-11H,1-7H2,(H2,18,20,21);5-6H,1-4H2 |
| InChIKey | IXVBKAFYMOTBMN-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.96 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|