C17H12F3NO2 — CID 171663174
1-methyl-7-[4-(trifluoromethyl)phenyl]indole-2-carboxylic acid (PubChem CID 171663174) has the molecular formula C17H12F3NO2 and a molecular weight of 319.28 g/mol. Its IUPAC name is 1-methyl-7-[4-(trifluoromethyl)phenyl]indole-2-carboxylic acid.
| Compound Name | 1-methyl-7-[4-(trifluoromethyl)phenyl]indole-2-carboxylic acid |
|---|---|
| PubChem CID | 171663174 |
| Molecular Formula | C17H12F3NO2 |
| Molecular Weight | 319.28 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | 1-methyl-7-[4-(trifluoromethyl)phenyl]indole-2-carboxylic acid |
| SMILES | Cn1c(C(=O)O)cc2cccc(-c3ccc(C(F)(F)F)cc3)c21 |
| InChI | InChI=1S/C17H12F3NO2/c1-21-14(16(22)23)9-11-3-2-4-13(15(11)21)10-5-7-12(8-6-10)17(18,19)20/h2-9H,1H3,(H,22,23) |
| InChIKey | QUDCGTHXGPQCBC-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.28 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |