C12H7FN4O2S2 — CID 171664639
N-(3-cyano-4-fluoro-1H-indol-7-yl)-1,3-thiazole-2-sulfonamide (PubChem CID 171664639) has the molecular formula C12H7FN4O2S2 and a molecular weight of 322.35 g/mol. Its IUPAC name is N-(3-cyano-4-fluoro-1H-indol-7-yl)-1,3-thiazole-2-sulfonamide.
| Compound Name | N-(3-cyano-4-fluoro-1H-indol-7-yl)-1,3-thiazole-2-sulfonamide |
|---|---|
| PubChem CID | 171664639 |
| Molecular Formula | C12H7FN4O2S2 |
| Molecular Weight | 322.35 g/mol |
| Exact Mass | 322.00 |
| IUPAC Name | N-(3-cyano-4-fluoro-1H-indol-7-yl)-1,3-thiazole-2-sulfonamide |
| SMILES | N#Cc1c[nH]c2c(NS(=O)(=O)c3nccs3)ccc(F)c12 |
| InChI | InChI=1S/C12H7FN4O2S2/c13-8-1-2-9(11-10(8)7(5-14)6-16-11)17-21(18,19)12-15-3-4-20-12/h1-4,6,16-17H |
| InChIKey | RAHSPIXKCMKJQO-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 98.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.35 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |