C18H20ClN3O3 — CID 171668608
1-(4-ethoxyphenyl)-2-(3-methoxyanilino)-4H-imidazol-5-one;hydrochloride (PubChem CID 171668608) has the molecular formula C18H20ClN3O3 and a molecular weight of 361.83 g/mol. Its IUPAC name is 1-(4-ethoxyphenyl)-2-(3-methoxyanilino)-4H-imidazol-5-one;hydrochloride.
| Compound Name | 1-(4-ethoxyphenyl)-2-(3-methoxyanilino)-4H-imidazol-5-one;hydrochloride |
|---|---|
| PubChem CID | 171668608 |
| Molecular Formula | C18H20ClN3O3 |
| Molecular Weight | 361.83 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | 1-(4-ethoxyphenyl)-2-(3-methoxyanilino)-4H-imidazol-5-one;hydrochloride |
| SMILES | CCOc1ccc(N2C(=O)CN=C2Nc2cccc(OC)c2)cc1.Cl |
| InChI | InChI=1S/C18H19N3O3.ClH/c1-3-24-15-9-7-14(8-10-15)21-17(22)12-19-18(21)20-13-5-4-6-16(11-13)23-2;/h4-11H,3,12H2,1-2H3,(H,19,20);1H |
| InChIKey | LXCBIYWLPXSCDD-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.83 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |