C30H35N2O7S5+ — CID 171669785
3-[(2E)-2-[(2E)-2-[[5,6-dimethyl-3-(3-sulfopropyl)thieno[2,3-d][1,3]thiazol-3-ium-2-yl]methylidene]butylidene]-5-methoxybenzo[e][1,3]benzothiazol-1-yl]propane-1-sulfonic acid (PubChem CID 171669785) has the molecular formula C30H35N2O7S5+ and a molecular weight of 695.95 g/mol. Its IUPAC name is 3-[(2E)-2-[(2E)-2-[[5,6-dimethyl-3-(3-sulfopropyl)thieno[2,3-d][1,3]thiazol-3-ium-2-yl]methylidene]butylidene]-5-methoxybenzo[e][1,3]benzothiazol-1-yl]propane-1-sulfonic acid.
| Compound Name | 3-[(2E)-2-[(2E)-2-[[5,6-dimethyl-3-(3-sulfopropyl)thieno[2,3-d][1,3]thiazol-3-ium-2-yl]methylidene]butylidene]-5-methoxybenzo[e][1,3]benzothiazol-1-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 171669785 |
| Molecular Formula | C30H35N2O7S5+ |
| Molecular Weight | 695.95 g/mol |
| Exact Mass | 695.10 |
| IUPAC Name | 3-[(2E)-2-[(2E)-2-[[5,6-dimethyl-3-(3-sulfopropyl)thieno[2,3-d][1,3]thiazol-3-ium-2-yl]methylidene]butylidene]-5-methoxybenzo[e][1,3]benzothiazol-1-yl]propane-1-sulfonic acid |
| SMILES | CCC(=C\c1sc2c(C)c(C)sc2[n+]1CCCS(=O)(=O)O)/C=C1/Sc2cc(OC)c3ccccc3c2N1CCCS(=O)(=O)O |
| InChI | InChI=1S/C30H34N2O7S5/c1-5-21(17-27-32(13-9-15-44(36,37)38)30-29(42-27)19(2)20(3)40-30)16-26-31(12-8-14-43(33,34)35)28-23-11-7-6-10-22(23)24(39-4)18-25(28)41-26/h6-7,10-11,16-18H,5,8-9,12-15H2,1-4H3,(H-,33,34,35,36,37,38)/p+1 |
| InChIKey | WWFZMSDIHSIATK-UHFFFAOYSA-O |
| XLogP | 6.83 |
| TPSA | 125.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.95 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|