C29H41N3O8 — CID 171672018
2-hydroxypropane-1,2,3-tricarboxylic acid;4-methyl-2-[[pyridin-4-ylmethyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]methyl]phenol (PubChem CID 171672018) has the molecular formula C29H41N3O8 and a molecular weight of 559.66 g/mol. Its IUPAC name is 2-hydroxypropane-1,2,3-tricarboxylic acid;4-methyl-2-[[pyridin-4-ylmethyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]methyl]phenol.
| Compound Name | 2-hydroxypropane-1,2,3-tricarboxylic acid;4-methyl-2-[[pyridin-4-ylmethyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]methyl]phenol |
|---|---|
| PubChem CID | 171672018 |
| Molecular Formula | C29H41N3O8 |
| Molecular Weight | 559.66 g/mol |
| Exact Mass | 559.29 |
| IUPAC Name | 2-hydroxypropane-1,2,3-tricarboxylic acid;4-methyl-2-[[pyridin-4-ylmethyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]methyl]phenol |
| SMILES | Cc1ccc(O)c(CN(Cc2ccncc2)C2CC(C)(C)NC(C)(C)C2)c1.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C23H33N3O.C6H8O7/c1-17-6-7-21(27)19(12-17)16-26(15-18-8-10-24-11-9-18)20-13-22(2,3)25-23(4,5)14-20;7-3(8)1-6(13,5(11)12)2-4(9)10/h6-12,20,25,27H,13-16H2,1-5H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | XBUBDCBPWDETRF-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 180.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.66 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|