C14H21F3N2O4 — CID 171674796
(1S,2R,3S,4R)-N-(2-hydroxyethyl)-3-[(3,3,3-trifluoro-2-hydroxy-2-methylpropanoyl)amino]bicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 171674796) has the molecular formula C14H21F3N2O4 and a molecular weight of 338.33 g/mol. Its IUPAC name is (1S,2R,3S,4R)-N-(2-hydroxyethyl)-3-[(3,3,3-trifluoro-2-hydroxy-2-methylpropanoyl)amino]bicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | (1S,2R,3S,4R)-N-(2-hydroxyethyl)-3-[(3,3,3-trifluoro-2-hydroxy-2-methylpropanoyl)amino]bicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 171674796 |
| Molecular Formula | C14H21F3N2O4 |
| Molecular Weight | 338.33 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | (1S,2R,3S,4R)-N-(2-hydroxyethyl)-3-[(3,3,3-trifluoro-2-hydroxy-2-methylpropanoyl)amino]bicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | CC(O)(C(=O)N[C@H]1[C@@H]2CC[C@@H](C2)[C@H]1C(=O)NCCO)C(F)(F)F |
| InChI | InChI=1S/C14H21F3N2O4/c1-13(23,14(15,16)17)12(22)19-10-8-3-2-7(6-8)9(10)11(21)18-4-5-20/h7-10,20,23H,2-6H2,1H3,(H,18,21)(H,19,22)/t7-,8+,9+,10-,13?/m0/s1 |
| InChIKey | JVMSXXRMTXYREN-RBIBQTEASA-N |
| XLogP | -0.06 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.33 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |