C24H26N4O3 — CID 171675011
[2-[(3R)-3-hydroxypiperidine-1-carbonyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]-naphthalen-1-ylmethanone (PubChem CID 171675011) has the molecular formula C24H26N4O3 and a molecular weight of 418.50 g/mol. Its IUPAC name is [2-[(3R)-3-hydroxypiperidine-1-carbonyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]-naphthalen-1-ylmethanone.
| Compound Name | [2-[(3R)-3-hydroxypiperidine-1-carbonyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]-naphthalen-1-ylmethanone |
|---|---|
| PubChem CID | 171675011 |
| Molecular Formula | C24H26N4O3 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | [2-[(3R)-3-hydroxypiperidine-1-carbonyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]-naphthalen-1-ylmethanone |
| SMILES | O=C(c1cc2n(n1)CCCN(C(=O)c1cccc3ccccc13)C2)N1CCC[C@@H](O)C1 |
| InChI | InChI=1S/C24H26N4O3/c29-19-8-4-11-27(16-19)24(31)22-14-18-15-26(12-5-13-28(18)25-22)23(30)21-10-3-7-17-6-1-2-9-20(17)21/h1-3,6-7,9-10,14,19,29H,4-5,8,11-13,15-16H2/t19-/m1/s1 |
| InChIKey | UQZFGTMHQOZLSV-LJQANCHMSA-N |
| XLogP | 2.68 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |