C20H23FN2O2 — CID 171675087
N-[(1R)-1-(4-fluorophenyl)-2-hydroxyethyl]-2-(pyrrolidin-1-ylmethyl)benzamide (PubChem CID 171675087) has the molecular formula C20H23FN2O2 and a molecular weight of 342.41 g/mol. Its IUPAC name is N-[(1R)-1-(4-fluorophenyl)-2-hydroxyethyl]-2-(pyrrolidin-1-ylmethyl)benzamide.
| Compound Name | N-[(1R)-1-(4-fluorophenyl)-2-hydroxyethyl]-2-(pyrrolidin-1-ylmethyl)benzamide |
|---|---|
| PubChem CID | 171675087 |
| Molecular Formula | C20H23FN2O2 |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | N-[(1R)-1-(4-fluorophenyl)-2-hydroxyethyl]-2-(pyrrolidin-1-ylmethyl)benzamide |
| SMILES | O=C(N[C@@H](CO)c1ccc(F)cc1)c1ccccc1CN1CCCC1 |
| InChI | InChI=1S/C20H23FN2O2/c21-17-9-7-15(8-10-17)19(14-24)22-20(25)18-6-2-1-5-16(18)13-23-11-3-4-12-23/h1-2,5-10,19,24H,3-4,11-14H2,(H,22,25)/t19-/m0/s1 |
| InChIKey | QQORWERZXYQUHX-IBGZPJMESA-N |
| XLogP | 2.88 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |