C30H36N2O4 — CID 171675504
tert-butyl 4-[[3-(3-methoxy-4-phenylmethoxyphenyl)phenyl]methyl]piperazine-1-carboxylate (PubChem CID 171675504) has the molecular formula C30H36N2O4 and a molecular weight of 488.63 g/mol. Its IUPAC name is tert-butyl 4-[[3-(3-methoxy-4-phenylmethoxyphenyl)phenyl]methyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[[3-(3-methoxy-4-phenylmethoxyphenyl)phenyl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 171675504 |
| Molecular Formula | C30H36N2O4 |
| Molecular Weight | 488.63 g/mol |
| Exact Mass | 488.27 |
| IUPAC Name | tert-butyl 4-[[3-(3-methoxy-4-phenylmethoxyphenyl)phenyl]methyl]piperazine-1-carboxylate |
| SMILES | COc1cc(-c2cccc(CN3CCN(C(=O)OC(C)(C)C)CC3)c2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C30H36N2O4/c1-30(2,3)36-29(33)32-17-15-31(16-18-32)21-24-11-8-12-25(19-24)26-13-14-27(28(20-26)34-4)35-22-23-9-6-5-7-10-23/h5-14,19-20H,15-18,21-22H2,1-4H3 |
| InChIKey | WGMQCLKKOHBWGE-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.63 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |