C25H35N3O4 — CID 171675967
(E)-1-[4-[1-[2-(oxan-4-yl)acetyl]piperidin-4-yl]oxypiperidin-1-yl]-3-pyridin-3-ylprop-2-en-1-one (PubChem CID 171675967) has the molecular formula C25H35N3O4 and a molecular weight of 441.57 g/mol. Its IUPAC name is (E)-1-[4-[1-[2-(oxan-4-yl)acetyl]piperidin-4-yl]oxypiperidin-1-yl]-3-pyridin-3-ylprop-2-en-1-one.
| Compound Name | (E)-1-[4-[1-[2-(oxan-4-yl)acetyl]piperidin-4-yl]oxypiperidin-1-yl]-3-pyridin-3-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 171675967 |
| Molecular Formula | C25H35N3O4 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.26 |
| IUPAC Name | (E)-1-[4-[1-[2-(oxan-4-yl)acetyl]piperidin-4-yl]oxypiperidin-1-yl]-3-pyridin-3-ylprop-2-en-1-one |
| SMILES | O=C(/C=C/c1cccnc1)N1CCC(OC2CCN(C(=O)CC3CCOCC3)CC2)CC1 |
| InChI | InChI=1S/C25H35N3O4/c29-24(4-3-21-2-1-11-26-19-21)27-12-5-22(6-13-27)32-23-7-14-28(15-8-23)25(30)18-20-9-16-31-17-10-20/h1-4,11,19-20,22-23H,5-10,12-18H2/b4-3+ |
| InChIKey | JLEKGLQWJJNNSG-ONEGZZNKSA-N |
| XLogP | 2.91 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|