C21H27F3N2O3 — CID 171679699
(1R,5R)-3-(3-ethoxypropanoyl)-N-[2-methyl-4-(trifluoromethyl)phenyl]-3-azabicyclo[3.2.1]octane-8-carboxamide (PubChem CID 171679699) has the molecular formula C21H27F3N2O3 and a molecular weight of 412.45 g/mol. Its IUPAC name is (1R,5R)-3-(3-ethoxypropanoyl)-N-[2-methyl-4-(trifluoromethyl)phenyl]-3-azabicyclo[3.2.1]octane-8-carboxamide.
| Compound Name | (1R,5R)-3-(3-ethoxypropanoyl)-N-[2-methyl-4-(trifluoromethyl)phenyl]-3-azabicyclo[3.2.1]octane-8-carboxamide |
|---|---|
| PubChem CID | 171679699 |
| Molecular Formula | C21H27F3N2O3 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | (1R,5R)-3-(3-ethoxypropanoyl)-N-[2-methyl-4-(trifluoromethyl)phenyl]-3-azabicyclo[3.2.1]octane-8-carboxamide |
| SMILES | CCOCCC(=O)N1C[C@@H]2CC[C@@H](C1)C2C(=O)Nc1ccc(C(F)(F)F)cc1C |
| InChI | InChI=1S/C21H27F3N2O3/c1-3-29-9-8-18(27)26-11-14-4-5-15(12-26)19(14)20(28)25-17-7-6-16(10-13(17)2)21(22,23)24/h6-7,10,14-15,19H,3-5,8-9,11-12H2,1-2H3,(H,25,28)/t14-,15-/m0/s1 |
| InChIKey | CHKPEEKZSJTMBO-GJZGRUSLSA-N |
| XLogP | 3.86 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|