C17H23N5O3 — CID 171680716
5-nitro-3-[[4-[[(2S)-oxolan-2-yl]methyl]piperazin-1-yl]methyl]-2H-indazole (PubChem CID 171680716) has the molecular formula C17H23N5O3 and a molecular weight of 345.40 g/mol. Its IUPAC name is 5-nitro-3-[[4-[[(2S)-oxolan-2-yl]methyl]piperazin-1-yl]methyl]-2H-indazole.
| Compound Name | 5-nitro-3-[[4-[[(2S)-oxolan-2-yl]methyl]piperazin-1-yl]methyl]-2H-indazole |
|---|---|
| PubChem CID | 171680716 |
| Molecular Formula | C17H23N5O3 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | 5-nitro-3-[[4-[[(2S)-oxolan-2-yl]methyl]piperazin-1-yl]methyl]-2H-indazole |
| SMILES | O=[N+]([O-])c1ccc2n[nH]c(CN3CCN(C[C@@H]4CCCO4)CC3)c2c1 |
| InChI | InChI=1S/C17H23N5O3/c23-22(24)13-3-4-16-15(10-13)17(19-18-16)12-21-7-5-20(6-8-21)11-14-2-1-9-25-14/h3-4,10,14H,1-2,5-9,11-12H2,(H,18,19)/t14-/m0/s1 |
| InChIKey | SBCWGRVFEXBFAN-AWEZNQCLSA-N |
| XLogP | 1.77 |
| TPSA | 87.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|