C30H28F3N3O4 — CID 171681297
1-(3-methoxyphenyl)-5-oxo-N-[4-[1-[[2-(2,3,6-trifluorophenyl)acetyl]amino]cyclobutyl]phenyl]pyrrolidine-3-carboxamide (PubChem CID 171681297) has the molecular formula C30H28F3N3O4 and a molecular weight of 551.57 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-5-oxo-N-[4-[1-[[2-(2,3,6-trifluorophenyl)acetyl]amino]cyclobutyl]phenyl]pyrrolidine-3-carboxamide.
| Compound Name | 1-(3-methoxyphenyl)-5-oxo-N-[4-[1-[[2-(2,3,6-trifluorophenyl)acetyl]amino]cyclobutyl]phenyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 171681297 |
| Molecular Formula | C30H28F3N3O4 |
| Molecular Weight | 551.57 g/mol |
| Exact Mass | 551.20 |
| IUPAC Name | 1-(3-methoxyphenyl)-5-oxo-N-[4-[1-[[2-(2,3,6-trifluorophenyl)acetyl]amino]cyclobutyl]phenyl]pyrrolidine-3-carboxamide |
| SMILES | COc1cccc(N2CC(C(=O)Nc3ccc(C4(NC(=O)Cc5c(F)ccc(F)c5F)CCC4)cc3)CC2=O)c1 |
| InChI | InChI=1S/C30H28F3N3O4/c1-40-22-5-2-4-21(15-22)36-17-18(14-27(36)38)29(39)34-20-8-6-19(7-9-20)30(12-3-13-30)35-26(37)16-23-24(31)10-11-25(32)28(23)33/h2,4-11,15,18H,3,12-14,16-17H2,1H3,(H,34,39)(H,35,37) |
| InChIKey | CLSNSUSLVUSZAG-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.57 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|