C29H26BrF2N3O3 — CID 171681485
4-bromo-N-[4-[1-[4-(cyclopropanecarbonylamino)benzoyl]piperidin-4-yl]phenyl]-2,5-difluorobenzamide (PubChem CID 171681485) has the molecular formula C29H26BrF2N3O3 and a molecular weight of 582.45 g/mol. Its IUPAC name is 4-bromo-N-[4-[1-[4-(cyclopropanecarbonylamino)benzoyl]piperidin-4-yl]phenyl]-2,5-difluorobenzamide.
| Compound Name | 4-bromo-N-[4-[1-[4-(cyclopropanecarbonylamino)benzoyl]piperidin-4-yl]phenyl]-2,5-difluorobenzamide |
|---|---|
| PubChem CID | 171681485 |
| Molecular Formula | C29H26BrF2N3O3 |
| Molecular Weight | 582.45 g/mol |
| Exact Mass | 581.11 |
| IUPAC Name | 4-bromo-N-[4-[1-[4-(cyclopropanecarbonylamino)benzoyl]piperidin-4-yl]phenyl]-2,5-difluorobenzamide |
| SMILES | O=C(Nc1ccc(C2CCN(C(=O)c3ccc(NC(=O)C4CC4)cc3)CC2)cc1)c1cc(F)c(Br)cc1F |
| InChI | InChI=1S/C29H26BrF2N3O3/c30-24-16-25(31)23(15-26(24)32)28(37)34-22-7-3-17(4-8-22)18-11-13-35(14-12-18)29(38)20-5-9-21(10-6-20)33-27(36)19-1-2-19/h3-10,15-16,18-19H,1-2,11-14H2,(H,33,36)(H,34,37) |
| InChIKey | WECCTPNMKWJKMR-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.45 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|