C28H22Cl3N5O2 — CID 171681503
[1-(1-pyridin-3-ylpyrazole-4-carbonyl)spiro[2H-indole-3,4'-piperidine]-1'-yl]-(3,4,5-trichlorophenyl)methanone (PubChem CID 171681503) has the molecular formula C28H22Cl3N5O2 and a molecular weight of 566.88 g/mol. Its IUPAC name is [1-(1-pyridin-3-ylpyrazole-4-carbonyl)spiro[2H-indole-3,4'-piperidine]-1'-yl]-(3,4,5-trichlorophenyl)methanone.
| Compound Name | [1-(1-pyridin-3-ylpyrazole-4-carbonyl)spiro[2H-indole-3,4'-piperidine]-1'-yl]-(3,4,5-trichlorophenyl)methanone |
|---|---|
| PubChem CID | 171681503 |
| Molecular Formula | C28H22Cl3N5O2 |
| Molecular Weight | 566.88 g/mol |
| Exact Mass | 565.08 |
| IUPAC Name | [1-(1-pyridin-3-ylpyrazole-4-carbonyl)spiro[2H-indole-3,4'-piperidine]-1'-yl]-(3,4,5-trichlorophenyl)methanone |
| SMILES | O=C(c1cc(Cl)c(Cl)c(Cl)c1)N1CCC2(CC1)CN(C(=O)c1cnn(-c3cccnc3)c1)c1ccccc12 |
| InChI | InChI=1S/C28H22Cl3N5O2/c29-22-12-18(13-23(30)25(22)31)26(37)34-10-7-28(8-11-34)17-35(24-6-2-1-5-21(24)28)27(38)19-14-33-36(16-19)20-4-3-9-32-15-20/h1-6,9,12-16H,7-8,10-11,17H2 |
| InChIKey | PXMKJVQLMUKRMX-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.88 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|