C28H25F3N4O3 — CID 171683788
N-[4-[1-(3-ethoxy-2,4,5-trifluorobenzoyl)piperidin-4-yl]phenyl]imidazo[1,5-a]pyridine-8-carboxamide (PubChem CID 171683788) has the molecular formula C28H25F3N4O3 and a molecular weight of 522.53 g/mol. Its IUPAC name is N-[4-[1-(3-ethoxy-2,4,5-trifluorobenzoyl)piperidin-4-yl]phenyl]imidazo[1,5-a]pyridine-8-carboxamide.
| Compound Name | N-[4-[1-(3-ethoxy-2,4,5-trifluorobenzoyl)piperidin-4-yl]phenyl]imidazo[1,5-a]pyridine-8-carboxamide |
|---|---|
| PubChem CID | 171683788 |
| Molecular Formula | C28H25F3N4O3 |
| Molecular Weight | 522.53 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | N-[4-[1-(3-ethoxy-2,4,5-trifluorobenzoyl)piperidin-4-yl]phenyl]imidazo[1,5-a]pyridine-8-carboxamide |
| SMILES | CCOc1c(F)c(F)cc(C(=O)N2CCC(c3ccc(NC(=O)c4cccn5cncc45)cc3)CC2)c1F |
| InChI | InChI=1S/C28H25F3N4O3/c1-2-38-26-24(30)21(14-22(29)25(26)31)28(37)34-12-9-18(10-13-34)17-5-7-19(8-6-17)33-27(36)20-4-3-11-35-16-32-15-23(20)35/h3-8,11,14-16,18H,2,9-10,12-13H2,1H3,(H,33,36) |
| InChIKey | HUYFOFJKFHKBQV-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.53 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|