C29H30F3N3O3 — CID 171685778
N-[4-[1-(3-ethoxy-2,4,5-trifluorobenzoyl)piperidin-4-yl]phenyl]-3-(2-methyl-3-pyridinyl)propanamide (PubChem CID 171685778) has the molecular formula C29H30F3N3O3 and a molecular weight of 525.57 g/mol. Its IUPAC name is N-[4-[1-(3-ethoxy-2,4,5-trifluorobenzoyl)piperidin-4-yl]phenyl]-3-(2-methyl-3-pyridinyl)propanamide.
| Compound Name | N-[4-[1-(3-ethoxy-2,4,5-trifluorobenzoyl)piperidin-4-yl]phenyl]-3-(2-methyl-3-pyridinyl)propanamide |
|---|---|
| PubChem CID | 171685778 |
| Molecular Formula | C29H30F3N3O3 |
| Molecular Weight | 525.57 g/mol |
| Exact Mass | 525.22 |
| IUPAC Name | N-[4-[1-(3-ethoxy-2,4,5-trifluorobenzoyl)piperidin-4-yl]phenyl]-3-(2-methyl-3-pyridinyl)propanamide |
| SMILES | CCOc1c(F)c(F)cc(C(=O)N2CCC(c3ccc(NC(=O)CCc4cccnc4C)cc3)CC2)c1F |
| InChI | InChI=1S/C29H30F3N3O3/c1-3-38-28-26(31)23(17-24(30)27(28)32)29(37)35-15-12-21(13-16-35)20-6-9-22(10-7-20)34-25(36)11-8-19-5-4-14-33-18(19)2/h4-7,9-10,14,17,21H,3,8,11-13,15-16H2,1-2H3,(H,34,36) |
| InChIKey | QEDKXORJGHABOF-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.57 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|