C29H25Cl3N4O4 — CID 171684904
(E)-N-[[4-[(4aS,7aR)-6-(3,4,5-trichlorobenzoyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine-4-carbonyl]phenyl]methyl]-3-pyridin-3-ylprop-2-enamide (PubChem CID 171684904) has the molecular formula C29H25Cl3N4O4 and a molecular weight of 599.90 g/mol. Its IUPAC name is (E)-N-[[4-[(4aS,7aR)-6-(3,4,5-trichlorobenzoyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine-4-carbonyl]phenyl]methyl]-3-pyridin-3-ylprop-2-enamide.
| Compound Name | (E)-N-[[4-[(4aS,7aR)-6-(3,4,5-trichlorobenzoyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine-4-carbonyl]phenyl]methyl]-3-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 171684904 |
| Molecular Formula | C29H25Cl3N4O4 |
| Molecular Weight | 599.90 g/mol |
| Exact Mass | 598.09 |
| IUPAC Name | (E)-N-[[4-[(4aS,7aR)-6-(3,4,5-trichlorobenzoyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine-4-carbonyl]phenyl]methyl]-3-pyridin-3-ylprop-2-enamide |
| SMILES | O=C(/C=C/c1cccnc1)NCc1ccc(C(=O)N2CCO[C@@H]3CN(C(=O)c4cc(Cl)c(Cl)c(Cl)c4)C[C@@H]32)cc1 |
| InChI | InChI=1S/C29H25Cl3N4O4/c30-22-12-21(13-23(31)27(22)32)28(38)35-16-24-25(17-35)40-11-10-36(24)29(39)20-6-3-19(4-7-20)15-34-26(37)8-5-18-2-1-9-33-14-18/h1-9,12-14,24-25H,10-11,15-17H2,(H,34,37)/b8-5+/t24-,25+/m0/s1 |
| InChIKey | WHRKNDNCUBLHBY-AQJKAMLLSA-N |
| XLogP | 4.74 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.90 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|