C30H29Cl3N4O3 — CID 171683548
[(4aS,7aR)-6-(3,4,5-trichlorobenzoyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-4-yl]-[(3S,4R)-4-phenyl-1-(pyridin-2-ylmethyl)pyrrolidin-3-yl]methanone (PubChem CID 171683548) has the molecular formula C30H29Cl3N4O3 and a molecular weight of 599.95 g/mol. Its IUPAC name is [(4aS,7aR)-6-(3,4,5-trichlorobenzoyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-4-yl]-[(3S,4R)-4-phenyl-1-(pyridin-2-ylmethyl)pyrrolidin-3-yl]methanone.
| Compound Name | [(4aS,7aR)-6-(3,4,5-trichlorobenzoyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-4-yl]-[(3S,4R)-4-phenyl-1-(pyridin-2-ylmethyl)pyrrolidin-3-yl]methanone |
|---|---|
| PubChem CID | 171683548 |
| Molecular Formula | C30H29Cl3N4O3 |
| Molecular Weight | 599.95 g/mol |
| Exact Mass | 598.13 |
| IUPAC Name | [(4aS,7aR)-6-(3,4,5-trichlorobenzoyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-4-yl]-[(3S,4R)-4-phenyl-1-(pyridin-2-ylmethyl)pyrrolidin-3-yl]methanone |
| SMILES | O=C(c1cc(Cl)c(Cl)c(Cl)c1)N1C[C@H]2OCCN(C(=O)[C@@H]3CN(Cc4ccccn4)C[C@H]3c3ccccc3)[C@H]2C1 |
| InChI | InChI=1S/C30H29Cl3N4O3/c31-24-12-20(13-25(32)28(24)33)29(38)36-17-26-27(18-36)40-11-10-37(26)30(39)23-16-35(14-21-8-4-5-9-34-21)15-22(23)19-6-2-1-3-7-19/h1-9,12-13,22-23,26-27H,10-11,14-18H2/t22-,23+,26-,27+/m0/s1 |
| InChIKey | PNNAGPVVUMFWOA-AYFYORAVSA-N |
| XLogP | 5.01 |
| TPSA | 65.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.95 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|