C16H13F3N4O2 — CID 171687141
4-methyl-6-quinolin-6-ylpyrimidin-2-amine;2,2,2-trifluoroacetic acid (PubChem CID 171687141) has the molecular formula C16H13F3N4O2 and a molecular weight of 350.30 g/mol. Its IUPAC name is 4-methyl-6-quinolin-6-ylpyrimidin-2-amine;2,2,2-trifluoroacetic acid.
| Compound Name | 4-methyl-6-quinolin-6-ylpyrimidin-2-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 171687141 |
| Molecular Formula | C16H13F3N4O2 |
| Molecular Weight | 350.30 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | 4-methyl-6-quinolin-6-ylpyrimidin-2-amine;2,2,2-trifluoroacetic acid |
| SMILES | Cc1cc(-c2ccc3ncccc3c2)nc(N)n1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H12N4.C2HF3O2/c1-9-7-13(18-14(15)17-9)11-4-5-12-10(8-11)3-2-6-16-12;3-2(4,5)1(6)7/h2-8H,1H3,(H2,15,17,18);(H,6,7) |
| InChIKey | LPOPCCQXRABJFZ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 101.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.30 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |