C17H21NO3S — CID 171688850
ethyl (2R)-2-[[2-(1-benzothiophen-2-yl)acetyl]amino]-3-methylbutanoate (PubChem CID 171688850) has the molecular formula C17H21NO3S and a molecular weight of 319.43 g/mol. Its IUPAC name is ethyl (2R)-2-[[2-(1-benzothiophen-2-yl)acetyl]amino]-3-methylbutanoate.
| Compound Name | ethyl (2R)-2-[[2-(1-benzothiophen-2-yl)acetyl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 171688850 |
| Molecular Formula | C17H21NO3S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | ethyl (2R)-2-[[2-(1-benzothiophen-2-yl)acetyl]amino]-3-methylbutanoate |
| SMILES | CCOC(=O)[C@H](NC(=O)Cc1cc2ccccc2s1)C(C)C |
| InChI | InChI=1S/C17H21NO3S/c1-4-21-17(20)16(11(2)3)18-15(19)10-13-9-12-7-5-6-8-14(12)22-13/h5-9,11,16H,4,10H2,1-3H3,(H,18,19)/t16-/m1/s1 |
| InChIKey | VMQOKFLWNHONHK-MRXNPFEDSA-N |
| XLogP | 3.15 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |