C16H20F3N3O3S — CID 171694619
1-[(2-methyl-1,3-thiazol-4-yl)methyl]-4-prop-2-enyl-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one;2,2,2-trifluoroacetic acid (PubChem CID 171694619) has the molecular formula C16H20F3N3O3S and a molecular weight of 391.42 g/mol. Its IUPAC name is 1-[(2-methyl-1,3-thiazol-4-yl)methyl]-4-prop-2-enyl-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[(2-methyl-1,3-thiazol-4-yl)methyl]-4-prop-2-enyl-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 171694619 |
| Molecular Formula | C16H20F3N3O3S |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | 1-[(2-methyl-1,3-thiazol-4-yl)methyl]-4-prop-2-enyl-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one;2,2,2-trifluoroacetic acid |
| SMILES | C=CCN1C(=O)CC2C1CCN2Cc1csc(C)n1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H19N3OS.C2HF3O2/c1-3-5-17-12-4-6-16(13(12)7-14(17)18)8-11-9-19-10(2)15-11;3-2(4,5)1(6)7/h3,9,12-13H,1,4-8H2,2H3;(H,6,7) |
| InChIKey | WZFFUKIPYGFSBD-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|