C21H27F6N5O4S — CID 171695501
2-[(7-ethyl-3-methylspiro[5,6-dihydroimidazo[1,2-a]pyrazine-8,4'-piperidine]-1'-yl)methyl]-1,3-thiazole;bis(2,2,2-trifluoroacetic acid) (PubChem CID 171695501) has the molecular formula C21H27F6N5O4S and a molecular weight of 559.53 g/mol. Its IUPAC name is 2-[(7-ethyl-3-methylspiro[5,6-dihydroimidazo[1,2-a]pyrazine-8,4'-piperidine]-1'-yl)methyl]-1,3-thiazole;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 2-[(7-ethyl-3-methylspiro[5,6-dihydroimidazo[1,2-a]pyrazine-8,4'-piperidine]-1'-yl)methyl]-1,3-thiazole;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 171695501 |
| Molecular Formula | C21H27F6N5O4S |
| Molecular Weight | 559.53 g/mol |
| Exact Mass | 559.17 |
| IUPAC Name | 2-[(7-ethyl-3-methylspiro[5,6-dihydroimidazo[1,2-a]pyrazine-8,4'-piperidine]-1'-yl)methyl]-1,3-thiazole;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CCN1CCn2c(C)cnc2C12CCN(Cc1nccs1)CC2.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H25N5S.2C2HF3O2/c1-3-21-9-10-22-14(2)12-19-16(22)17(21)4-7-20(8-5-17)13-15-18-6-11-23-15;2*3-2(4,5)1(6)7/h6,11-12H,3-5,7-10,13H2,1-2H3;2*(H,6,7) |
| InChIKey | WPKMJLPXOJLFEA-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 111.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.53 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |