C19H25F6N5O4S — CID 155825247
N-ethyl-N-[[7-(1,3-thiazol-2-ylmethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-2-yl]methyl]ethanamine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155825247) has the molecular formula C19H25F6N5O4S and a molecular weight of 533.50 g/mol. Its IUPAC name is N-ethyl-N-[[7-(1,3-thiazol-2-ylmethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-2-yl]methyl]ethanamine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | N-ethyl-N-[[7-(1,3-thiazol-2-ylmethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-2-yl]methyl]ethanamine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155825247 |
| Molecular Formula | C19H25F6N5O4S |
| Molecular Weight | 533.50 g/mol |
| Exact Mass | 533.15 |
| IUPAC Name | N-ethyl-N-[[7-(1,3-thiazol-2-ylmethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-2-yl]methyl]ethanamine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CCN(CC)Cc1cn2c(n1)CN(Cc1nccs1)CC2.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H23N5S.2C2HF3O2/c1-3-18(4-2)9-13-10-20-7-6-19(11-14(20)17-13)12-15-16-5-8-21-15;2*3-2(4,5)1(6)7/h5,8,10H,3-4,6-7,9,11-12H2,1-2H3;2*(H,6,7) |
| InChIKey | XVBKFHPMCVCDRN-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 111.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.50 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |