C17H20F3N7O2S — CID 155828963
2-methyl-4-[[8-methyl-3-(1,2,4-triazol-1-ylmethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl]methyl]-1,3-thiazole;2,2,2-trifluoroacetic acid (PubChem CID 155828963) has the molecular formula C17H20F3N7O2S and a molecular weight of 443.46 g/mol. Its IUPAC name is 2-methyl-4-[[8-methyl-3-(1,2,4-triazol-1-ylmethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl]methyl]-1,3-thiazole;2,2,2-trifluoroacetic acid.
| Compound Name | 2-methyl-4-[[8-methyl-3-(1,2,4-triazol-1-ylmethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl]methyl]-1,3-thiazole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155828963 |
| Molecular Formula | C17H20F3N7O2S |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | 2-methyl-4-[[8-methyl-3-(1,2,4-triazol-1-ylmethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl]methyl]-1,3-thiazole;2,2,2-trifluoroacetic acid |
| SMILES | Cc1nc(CN2CCn3c(Cn4cncn4)cnc3C2C)cs1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H19N7S.C2HF3O2/c1-11-15-17-5-14(7-21-10-16-9-18-21)22(15)4-3-20(11)6-13-8-23-12(2)19-13;3-2(4,5)1(6)7/h5,8-11H,3-4,6-7H2,1-2H3;(H,6,7) |
| InChIKey | QUJYZEDJKILSBL-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 101.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |