C18H19F6N7O4S — CID 155828203
2-methyl-4-[[3-(1,2,4-triazol-1-ylmethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl]methyl]-1,3-thiazole;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155828203) has the molecular formula C18H19F6N7O4S and a molecular weight of 543.45 g/mol. Its IUPAC name is 2-methyl-4-[[3-(1,2,4-triazol-1-ylmethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl]methyl]-1,3-thiazole;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 2-methyl-4-[[3-(1,2,4-triazol-1-ylmethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl]methyl]-1,3-thiazole;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155828203 |
| Molecular Formula | C18H19F6N7O4S |
| Molecular Weight | 543.45 g/mol |
| Exact Mass | 543.11 |
| IUPAC Name | 2-methyl-4-[[3-(1,2,4-triazol-1-ylmethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl]methyl]-1,3-thiazole;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cc1nc(CN2CCn3c(Cn4cncn4)cnc3C2)cs1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H17N7S.2C2HF3O2/c1-11-18-12(8-22-11)5-19-2-3-21-13(4-16-14(21)7-19)6-20-10-15-9-17-20;2*3-2(4,5)1(6)7/h4,8-10H,2-3,5-7H2,1H3;2*(H,6,7) |
| InChIKey | LQOWJWWIHPIWKU-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 139.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.45 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |