C12H10Cl2N2O3S — CID 171697828
2,3-dichloro-N-[(3-hydroxy-2-pyridinyl)methyl]benzenesulfonamide (PubChem CID 171697828) has the molecular formula C12H10Cl2N2O3S and a molecular weight of 333.20 g/mol. Its IUPAC name is 2,3-dichloro-N-[(3-hydroxy-2-pyridinyl)methyl]benzenesulfonamide.
| Compound Name | 2,3-dichloro-N-[(3-hydroxy-2-pyridinyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 171697828 |
| Molecular Formula | C12H10Cl2N2O3S |
| Molecular Weight | 333.20 g/mol |
| Exact Mass | 331.98 |
| IUPAC Name | 2,3-dichloro-N-[(3-hydroxy-2-pyridinyl)methyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCc1ncccc1O)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C12H10Cl2N2O3S/c13-8-3-1-5-11(12(8)14)20(18,19)16-7-9-10(17)4-2-6-15-9/h1-6,16-17H,7H2 |
| InChIKey | HASFNAOLYBXPHV-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.20 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |