C17H14F2N4O — CID 171697953
1-(3,4-difluorophenyl)-3-[(4-imidazol-1-ylphenyl)methyl]urea (PubChem CID 171697953) has the molecular formula C17H14F2N4O and a molecular weight of 328.32 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-3-[(4-imidazol-1-ylphenyl)methyl]urea.
| Compound Name | 1-(3,4-difluorophenyl)-3-[(4-imidazol-1-ylphenyl)methyl]urea |
|---|---|
| PubChem CID | 171697953 |
| Molecular Formula | C17H14F2N4O |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 1-(3,4-difluorophenyl)-3-[(4-imidazol-1-ylphenyl)methyl]urea |
| SMILES | O=C(NCc1ccc(-n2ccnc2)cc1)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C17H14F2N4O/c18-15-6-3-13(9-16(15)19)22-17(24)21-10-12-1-4-14(5-2-12)23-8-7-20-11-23/h1-9,11H,10H2,(H2,21,22,24) |
| InChIKey | OTLHFJONRAXYHG-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |