C24H29FN4O — CID 171698305
N-butan-2-yl-7-fluoro-N-methyl-2-(3-phenoxypiperidin-1-yl)quinazolin-4-amine (PubChem CID 171698305) has the molecular formula C24H29FN4O and a molecular weight of 408.52 g/mol. Its IUPAC name is N-butan-2-yl-7-fluoro-N-methyl-2-(3-phenoxypiperidin-1-yl)quinazolin-4-amine.
| Compound Name | N-butan-2-yl-7-fluoro-N-methyl-2-(3-phenoxypiperidin-1-yl)quinazolin-4-amine |
|---|---|
| PubChem CID | 171698305 |
| Molecular Formula | C24H29FN4O |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | N-butan-2-yl-7-fluoro-N-methyl-2-(3-phenoxypiperidin-1-yl)quinazolin-4-amine |
| SMILES | CCC(C)N(C)c1nc(N2CCCC(Oc3ccccc3)C2)nc2cc(F)ccc12 |
| InChI | InChI=1S/C24H29FN4O/c1-4-17(2)28(3)23-21-13-12-18(25)15-22(21)26-24(27-23)29-14-8-11-20(16-29)30-19-9-6-5-7-10-19/h5-7,9-10,12-13,15,17,20H,4,8,11,14,16H2,1-3H3 |
| InChIKey | IGKXGOISVYZUGG-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |