C35H31N3O5 — CID 171698576
(Z)-N-[4-[1-[4-(1,3-dioxoisoindol-2-yl)benzoyl]piperidin-4-yl]phenyl]-2-methyl-3-(5-methylfuran-2-yl)prop-2-enamide (PubChem CID 171698576) has the molecular formula C35H31N3O5 and a molecular weight of 573.65 g/mol. Its IUPAC name is (Z)-N-[4-[1-[4-(1,3-dioxoisoindol-2-yl)benzoyl]piperidin-4-yl]phenyl]-2-methyl-3-(5-methylfuran-2-yl)prop-2-enamide.
| Compound Name | (Z)-N-[4-[1-[4-(1,3-dioxoisoindol-2-yl)benzoyl]piperidin-4-yl]phenyl]-2-methyl-3-(5-methylfuran-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 171698576 |
| Molecular Formula | C35H31N3O5 |
| Molecular Weight | 573.65 g/mol |
| Exact Mass | 573.23 |
| IUPAC Name | (Z)-N-[4-[1-[4-(1,3-dioxoisoindol-2-yl)benzoyl]piperidin-4-yl]phenyl]-2-methyl-3-(5-methylfuran-2-yl)prop-2-enamide |
| SMILES | C/C(=C/c1ccc(C)o1)C(=O)Nc1ccc(C2CCN(C(=O)c3ccc(N4C(=O)c5ccccc5C4=O)cc3)CC2)cc1 |
| InChI | InChI=1S/C35H31N3O5/c1-22(21-29-16-7-23(2)43-29)32(39)36-27-12-8-24(9-13-27)25-17-19-37(20-18-25)33(40)26-10-14-28(15-11-26)38-34(41)30-5-3-4-6-31(30)35(38)42/h3-16,21,25H,17-20H2,1-2H3,(H,36,39)/b22-21- |
| InChIKey | MMUCSGKMMKQJEN-DQRAZIAOSA-N |
| XLogP | 6.45 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.65 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|