C35H29N5O4 — CID 171698643
N-[4-[1-[4-(1,3-dioxoisoindol-2-yl)benzoyl]piperidin-4-yl]phenyl]-1-methylindazole-5-carboxamide (PubChem CID 171698643) has the molecular formula C35H29N5O4 and a molecular weight of 583.65 g/mol. Its IUPAC name is N-[4-[1-[4-(1,3-dioxoisoindol-2-yl)benzoyl]piperidin-4-yl]phenyl]-1-methylindazole-5-carboxamide.
| Compound Name | N-[4-[1-[4-(1,3-dioxoisoindol-2-yl)benzoyl]piperidin-4-yl]phenyl]-1-methylindazole-5-carboxamide |
|---|---|
| PubChem CID | 171698643 |
| Molecular Formula | C35H29N5O4 |
| Molecular Weight | 583.65 g/mol |
| Exact Mass | 583.22 |
| IUPAC Name | N-[4-[1-[4-(1,3-dioxoisoindol-2-yl)benzoyl]piperidin-4-yl]phenyl]-1-methylindazole-5-carboxamide |
| SMILES | Cn1ncc2cc(C(=O)Nc3ccc(C4CCN(C(=O)c5ccc(N6C(=O)c7ccccc7C6=O)cc5)CC4)cc3)ccc21 |
| InChI | InChI=1S/C35H29N5O4/c1-38-31-15-10-25(20-26(31)21-36-38)32(41)37-27-11-6-22(7-12-27)23-16-18-39(19-17-23)33(42)24-8-13-28(14-9-24)40-34(43)29-4-2-3-5-30(29)35(40)44/h2-15,20-21,23H,16-19H2,1H3,(H,37,41) |
| InChIKey | HBURFRLWQUUADX-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 104.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.65 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|