C23H22O6S — CID 171699249
benzyl 4-(5-methoxy-2,4-dimethylphenyl)sulfonyloxybenzoate (PubChem CID 171699249) has the molecular formula C23H22O6S and a molecular weight of 426.49 g/mol. Its IUPAC name is benzyl 4-(5-methoxy-2,4-dimethylphenyl)sulfonyloxybenzoate.
| Compound Name | benzyl 4-(5-methoxy-2,4-dimethylphenyl)sulfonyloxybenzoate |
|---|---|
| PubChem CID | 171699249 |
| Molecular Formula | C23H22O6S |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | benzyl 4-(5-methoxy-2,4-dimethylphenyl)sulfonyloxybenzoate |
| SMILES | COc1cc(S(=O)(=O)Oc2ccc(C(=O)OCc3ccccc3)cc2)c(C)cc1C |
| InChI | InChI=1S/C23H22O6S/c1-16-13-17(2)22(14-21(16)27-3)30(25,26)29-20-11-9-19(10-12-20)23(24)28-15-18-7-5-4-6-8-18/h4-14H,15H2,1-3H3 |
| InChIKey | DDDMTRDWEUKFCH-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|