C22H26BrNO4 — CID 17170286
5-bromo-2-(2-methylpropoxy)-N-[2-(oxolan-2-ylmethoxy)phenyl]benzamide (PubChem CID 17170286) has the molecular formula C22H26BrNO4 and a molecular weight of 448.36 g/mol. Its IUPAC name is 5-bromo-2-(2-methylpropoxy)-N-[2-(oxolan-2-ylmethoxy)phenyl]benzamide.
| Compound Name | 5-bromo-2-(2-methylpropoxy)-N-[2-(oxolan-2-ylmethoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 17170286 |
| Molecular Formula | C22H26BrNO4 |
| Molecular Weight | 448.36 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | 5-bromo-2-(2-methylpropoxy)-N-[2-(oxolan-2-ylmethoxy)phenyl]benzamide |
| SMILES | CC(C)COc1ccc(Br)cc1C(=O)Nc1ccccc1OCC1CCCO1 |
| InChI | InChI=1S/C22H26BrNO4/c1-15(2)13-27-20-10-9-16(23)12-18(20)22(25)24-19-7-3-4-8-21(19)28-14-17-6-5-11-26-17/h3-4,7-10,12,15,17H,5-6,11,13-14H2,1-2H3,(H,24,25) |
| InChIKey | PIAQYSUXCBPYQF-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.36 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |