C25H26BrNO4 — CID 17130986
5-bromo-2-(2-methylpropoxy)-N-[2-(2-phenoxyethoxy)phenyl]benzamide (PubChem CID 17130986) has the molecular formula C25H26BrNO4 and a molecular weight of 484.39 g/mol. Its IUPAC name is 5-bromo-2-(2-methylpropoxy)-N-[2-(2-phenoxyethoxy)phenyl]benzamide.
| Compound Name | 5-bromo-2-(2-methylpropoxy)-N-[2-(2-phenoxyethoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 17130986 |
| Molecular Formula | C25H26BrNO4 |
| Molecular Weight | 484.39 g/mol |
| Exact Mass | 483.10 |
| IUPAC Name | 5-bromo-2-(2-methylpropoxy)-N-[2-(2-phenoxyethoxy)phenyl]benzamide |
| SMILES | CC(C)COc1ccc(Br)cc1C(=O)Nc1ccccc1OCCOc1ccccc1 |
| InChI | InChI=1S/C25H26BrNO4/c1-18(2)17-31-23-13-12-19(26)16-21(23)25(28)27-22-10-6-7-11-24(22)30-15-14-29-20-8-4-3-5-9-20/h3-13,16,18H,14-15,17H2,1-2H3,(H,27,28) |
| InChIKey | SXOLKXWCZBDCJN-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.39 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|