C16H22FN3O4S — CID 171704720
[3-[(6-fluoro-2-pyridinyl)oxy]pyrrolidin-1-yl]-(1-methylsulfonylpiperidin-4-yl)methanone (PubChem CID 171704720) has the molecular formula C16H22FN3O4S and a molecular weight of 371.43 g/mol. Its IUPAC name is [3-[(6-fluoro-2-pyridinyl)oxy]pyrrolidin-1-yl]-(1-methylsulfonylpiperidin-4-yl)methanone.
| Compound Name | [3-[(6-fluoro-2-pyridinyl)oxy]pyrrolidin-1-yl]-(1-methylsulfonylpiperidin-4-yl)methanone |
|---|---|
| PubChem CID | 171704720 |
| Molecular Formula | C16H22FN3O4S |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | [3-[(6-fluoro-2-pyridinyl)oxy]pyrrolidin-1-yl]-(1-methylsulfonylpiperidin-4-yl)methanone |
| SMILES | CS(=O)(=O)N1CCC(C(=O)N2CCC(Oc3cccc(F)n3)C2)CC1 |
| InChI | InChI=1S/C16H22FN3O4S/c1-25(22,23)20-9-5-12(6-10-20)16(21)19-8-7-13(11-19)24-15-4-2-3-14(17)18-15/h2-4,12-13H,5-11H2,1H3 |
| InChIKey | YUDKFPGFTWVHSR-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|