C16H23FN2O3S — CID 172893200
2-(1-cyclohexylsulfonylpiperidin-4-yl)oxy-6-fluoropyridine (PubChem CID 172893200) has the molecular formula C16H23FN2O3S and a molecular weight of 342.44 g/mol. Its IUPAC name is 2-(1-cyclohexylsulfonylpiperidin-4-yl)oxy-6-fluoropyridine.
| Compound Name | 2-(1-cyclohexylsulfonylpiperidin-4-yl)oxy-6-fluoropyridine |
|---|---|
| PubChem CID | 172893200 |
| Molecular Formula | C16H23FN2O3S |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 2-(1-cyclohexylsulfonylpiperidin-4-yl)oxy-6-fluoropyridine |
| SMILES | O=S(=O)(C1CCCCC1)N1CCC(Oc2cccc(F)n2)CC1 |
| InChI | InChI=1S/C16H23FN2O3S/c17-15-7-4-8-16(18-15)22-13-9-11-19(12-10-13)23(20,21)14-5-2-1-3-6-14/h4,7-8,13-14H,1-3,5-6,9-12H2 |
| InChIKey | DKZXHGALJOIJCT-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|