C24H26N4O5S — CID 171709796
2-amino-4-(2,4-dimethoxyphenyl)-6-[4-(morpholin-4-ylmethyl)thiophen-2-yl]pyridine-3-carbonitrile;formic acid (PubChem CID 171709796) has the molecular formula C24H26N4O5S and a molecular weight of 482.56 g/mol. Its IUPAC name is 2-amino-4-(2,4-dimethoxyphenyl)-6-[4-(morpholin-4-ylmethyl)thiophen-2-yl]pyridine-3-carbonitrile;formic acid.
| Compound Name | 2-amino-4-(2,4-dimethoxyphenyl)-6-[4-(morpholin-4-ylmethyl)thiophen-2-yl]pyridine-3-carbonitrile;formic acid |
|---|---|
| PubChem CID | 171709796 |
| Molecular Formula | C24H26N4O5S |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | 2-amino-4-(2,4-dimethoxyphenyl)-6-[4-(morpholin-4-ylmethyl)thiophen-2-yl]pyridine-3-carbonitrile;formic acid |
| SMILES | COc1ccc(-c2cc(-c3cc(CN4CCOCC4)cs3)nc(N)c2C#N)c(OC)c1.O=CO |
| InChI | InChI=1S/C23H24N4O3S.CH2O2/c1-28-16-3-4-17(21(10-16)29-2)18-11-20(26-23(25)19(18)12-24)22-9-15(14-31-22)13-27-5-7-30-8-6-27;2-1-3/h3-4,9-11,14H,5-8,13H2,1-2H3,(H2,25,26);1H,(H,2,3) |
| InChIKey | ZKVWKERUFJSWJT-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 130.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|