C20H24N4O2S — CID 171385428
3-[6-amino-5-cyano-4-[4-(piperidin-1-ylmethyl)thiophen-2-yl]-2-pyridinyl]butanoic acid (PubChem CID 171385428) has the molecular formula C20H24N4O2S and a molecular weight of 384.51 g/mol. Its IUPAC name is 3-[6-amino-5-cyano-4-[4-(piperidin-1-ylmethyl)thiophen-2-yl]-2-pyridinyl]butanoic acid.
| Compound Name | 3-[6-amino-5-cyano-4-[4-(piperidin-1-ylmethyl)thiophen-2-yl]-2-pyridinyl]butanoic acid |
|---|---|
| PubChem CID | 171385428 |
| Molecular Formula | C20H24N4O2S |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 3-[6-amino-5-cyano-4-[4-(piperidin-1-ylmethyl)thiophen-2-yl]-2-pyridinyl]butanoic acid |
| SMILES | CC(CC(=O)O)c1cc(-c2cc(CN3CCCCC3)cs2)c(C#N)c(N)n1 |
| InChI | InChI=1S/C20H24N4O2S/c1-13(7-19(25)26)17-9-15(16(10-21)20(22)23-17)18-8-14(12-27-18)11-24-5-3-2-4-6-24/h8-9,12-13H,2-7,11H2,1H3,(H2,22,23)(H,25,26) |
| InChIKey | FNTBXGAKVNDHBN-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 103.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |