C13H21ClN4OS — CID 90485718
[(E)-[4-(azepan-1-ylmethyl)thiophen-2-yl]methylideneamino]urea;hydrochloride (PubChem CID 90485718) has the molecular formula C13H21ClN4OS and a molecular weight of 316.86 g/mol. Its IUPAC name is [(E)-[4-(azepan-1-ylmethyl)thiophen-2-yl]methylideneamino]urea;hydrochloride.
| Compound Name | [(E)-[4-(azepan-1-ylmethyl)thiophen-2-yl]methylideneamino]urea;hydrochloride |
|---|---|
| PubChem CID | 90485718 |
| Molecular Formula | C13H21ClN4OS |
| Molecular Weight | 316.86 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | [(E)-[4-(azepan-1-ylmethyl)thiophen-2-yl]methylideneamino]urea;hydrochloride |
| SMILES | Cl.NC(=O)N/N=C/c1cc(CN2CCCCCC2)cs1 |
| InChI | InChI=1S/C13H20N4OS.ClH/c14-13(18)16-15-8-12-7-11(10-19-12)9-17-5-3-1-2-4-6-17;/h7-8,10H,1-6,9H2,(H3,14,16,18);1H/b15-8+; |
| InChIKey | PZDJIHIJXKXTKO-TWNLEINFSA-N |
| XLogP | 2.55 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.86 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|