C25H26N4O2S — CID 89347102
N-formyl-2-[(E)-[[4-(piperidin-1-ylmethyl)phenyl]hydrazinylidene]methyl]-4-thiophen-3-ylbenzamide (PubChem CID 89347102) has the molecular formula C25H26N4O2S and a molecular weight of 446.58 g/mol. Its IUPAC name is N-formyl-2-[(E)-[[4-(piperidin-1-ylmethyl)phenyl]hydrazinylidene]methyl]-4-thiophen-3-ylbenzamide.
| Compound Name | N-formyl-2-[(E)-[[4-(piperidin-1-ylmethyl)phenyl]hydrazinylidene]methyl]-4-thiophen-3-ylbenzamide |
|---|---|
| PubChem CID | 89347102 |
| Molecular Formula | C25H26N4O2S |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | N-formyl-2-[(E)-[[4-(piperidin-1-ylmethyl)phenyl]hydrazinylidene]methyl]-4-thiophen-3-ylbenzamide |
| SMILES | O=CNC(=O)c1ccc(-c2ccsc2)cc1/C=N/Nc1ccc(CN2CCCCC2)cc1 |
| InChI | InChI=1S/C25H26N4O2S/c30-18-26-25(31)24-9-6-20(21-10-13-32-17-21)14-22(24)15-27-28-23-7-4-19(5-8-23)16-29-11-2-1-3-12-29/h4-10,13-15,17-18,28H,1-3,11-12,16H2,(H,26,30,31)/b27-15+ |
| InChIKey | IYKKPYRMDORTCV-JFLMPSFJSA-N |
| XLogP | 4.73 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|