C23H34N2O5 — CID 171710353
formic acid;[3-[(3-hydroxyphenyl)methyl]pyrrolidin-1-yl]-(1-morpholin-4-ylcyclohexyl)methanone (PubChem CID 171710353) has the molecular formula C23H34N2O5 and a molecular weight of 418.53 g/mol. Its IUPAC name is formic acid;[3-[(3-hydroxyphenyl)methyl]pyrrolidin-1-yl]-(1-morpholin-4-ylcyclohexyl)methanone.
| Compound Name | formic acid;[3-[(3-hydroxyphenyl)methyl]pyrrolidin-1-yl]-(1-morpholin-4-ylcyclohexyl)methanone |
|---|---|
| PubChem CID | 171710353 |
| Molecular Formula | C23H34N2O5 |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.25 |
| IUPAC Name | formic acid;[3-[(3-hydroxyphenyl)methyl]pyrrolidin-1-yl]-(1-morpholin-4-ylcyclohexyl)methanone |
| SMILES | O=C(N1CCC(Cc2cccc(O)c2)C1)C1(N2CCOCC2)CCCCC1.O=CO |
| InChI | InChI=1S/C22H32N2O3.CH2O2/c25-20-6-4-5-18(16-20)15-19-7-10-23(17-19)21(26)22(8-2-1-3-9-22)24-11-13-27-14-12-24;2-1-3/h4-6,16,19,25H,1-3,7-15,17H2;1H,(H,2,3) |
| InChIKey | SOJFBUBRLWBMJC-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|