C19H21ClN2O4 — CID 171710365
5-[3-[(4-chlorophenyl)methyl]pyrrolidine-1-carbonyl]-2-methyl-1H-pyridin-4-one;formic acid (PubChem CID 171710365) has the molecular formula C19H21ClN2O4 and a molecular weight of 376.84 g/mol. Its IUPAC name is 5-[3-[(4-chlorophenyl)methyl]pyrrolidine-1-carbonyl]-2-methyl-1H-pyridin-4-one;formic acid.
| Compound Name | 5-[3-[(4-chlorophenyl)methyl]pyrrolidine-1-carbonyl]-2-methyl-1H-pyridin-4-one;formic acid |
|---|---|
| PubChem CID | 171710365 |
| Molecular Formula | C19H21ClN2O4 |
| Molecular Weight | 376.84 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 5-[3-[(4-chlorophenyl)methyl]pyrrolidine-1-carbonyl]-2-methyl-1H-pyridin-4-one;formic acid |
| SMILES | Cc1cc(=O)c(C(=O)N2CCC(Cc3ccc(Cl)cc3)C2)c[nH]1.O=CO |
| InChI | InChI=1S/C18H19ClN2O2.CH2O2/c1-12-8-17(22)16(10-20-12)18(23)21-7-6-14(11-21)9-13-2-4-15(19)5-3-13;2-1-3/h2-5,8,10,14H,6-7,9,11H2,1H3,(H,20,22);1H,(H,2,3) |
| InChIKey | ZUXYHNUSKSCOPZ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 90.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.84 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|