C22H31Cl2N3O3 — CID 171713333
4-methyl-2-oxo-6-pentan-2-yl-N-(4-piperazin-1-ylphenyl)pyran-3-carboxamide;dihydrochloride (PubChem CID 171713333) has the molecular formula C22H31Cl2N3O3 and a molecular weight of 456.41 g/mol. Its IUPAC name is 4-methyl-2-oxo-6-pentan-2-yl-N-(4-piperazin-1-ylphenyl)pyran-3-carboxamide;dihydrochloride.
| Compound Name | 4-methyl-2-oxo-6-pentan-2-yl-N-(4-piperazin-1-ylphenyl)pyran-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 171713333 |
| Molecular Formula | C22H31Cl2N3O3 |
| Molecular Weight | 456.41 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | 4-methyl-2-oxo-6-pentan-2-yl-N-(4-piperazin-1-ylphenyl)pyran-3-carboxamide;dihydrochloride |
| SMILES | CCCC(C)c1cc(C)c(C(=O)Nc2ccc(N3CCNCC3)cc2)c(=O)o1.Cl.Cl |
| InChI | InChI=1S/C22H29N3O3.2ClH/c1-4-5-15(2)19-14-16(3)20(22(27)28-19)21(26)24-17-6-8-18(9-7-17)25-12-10-23-11-13-25;;/h6-9,14-15,23H,4-5,10-13H2,1-3H3,(H,24,26);2*1H |
| InChIKey | ZMIOTGAIXQEQGL-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.41 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|