C13H11NO2 — CID 171715126
2-methyl-9H-carbazole-1,6-diol (PubChem CID 171715126) has the molecular formula C13H11NO2 and a molecular weight of 213.24 g/mol. Its IUPAC name is 2-methyl-9H-carbazole-1,6-diol.
| Compound Name | 2-methyl-9H-carbazole-1,6-diol |
|---|---|
| PubChem CID | 171715126 |
| Molecular Formula | C13H11NO2 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | 2-methyl-9H-carbazole-1,6-diol |
| SMILES | Cc1ccc2c([nH]c3ccc(O)cc32)c1O |
| InChI | InChI=1S/C13H11NO2/c1-7-2-4-9-10-6-8(15)3-5-11(10)14-12(9)13(7)16/h2-6,14-16H,1H3 |
| InChIKey | VPRVAYGQYABFMK-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |