C13H11NO4 — CID 171715135
2-methyl-9H-carbazole-1,5,6,7-tetrol (PubChem CID 171715135) has the molecular formula C13H11NO4 and a molecular weight of 245.23 g/mol. Its IUPAC name is 2-methyl-9H-carbazole-1,5,6,7-tetrol.
| Compound Name | 2-methyl-9H-carbazole-1,5,6,7-tetrol |
|---|---|
| PubChem CID | 171715135 |
| Molecular Formula | C13H11NO4 |
| Molecular Weight | 245.23 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 2-methyl-9H-carbazole-1,5,6,7-tetrol |
| SMILES | Cc1ccc2c([nH]c3cc(O)c(O)c(O)c32)c1O |
| InChI | InChI=1S/C13H11NO4/c1-5-2-3-6-9-7(14-10(6)11(5)16)4-8(15)12(17)13(9)18/h2-4,14-18H,1H3 |
| InChIKey | RZPYCDCWOFKVIA-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 96.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.23 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|