C13H10F6N2OS — CID 171715904
3-[[2,4-bis(trifluoromethyl)phenyl]methyl]-5-(hydroxymethyl)-1H-imidazole-2-thione (PubChem CID 171715904) has the molecular formula C13H10F6N2OS and a molecular weight of 356.29 g/mol. Its IUPAC name is 3-[[2,4-bis(trifluoromethyl)phenyl]methyl]-5-(hydroxymethyl)-1H-imidazole-2-thione.
| Compound Name | 3-[[2,4-bis(trifluoromethyl)phenyl]methyl]-5-(hydroxymethyl)-1H-imidazole-2-thione |
|---|---|
| PubChem CID | 171715904 |
| Molecular Formula | C13H10F6N2OS |
| Molecular Weight | 356.29 g/mol |
| Exact Mass | 356.04 |
| IUPAC Name | 3-[[2,4-bis(trifluoromethyl)phenyl]methyl]-5-(hydroxymethyl)-1H-imidazole-2-thione |
| SMILES | OCc1cn(Cc2ccc(C(F)(F)F)cc2C(F)(F)F)c(=S)[nH]1 |
| InChI | InChI=1S/C13H10F6N2OS/c14-12(15,16)8-2-1-7(10(3-8)13(17,18)19)4-21-5-9(6-22)20-11(21)23/h1-3,5,22H,4,6H2,(H,20,23) |
| InChIKey | WXKONROFPLKHOA-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 40.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.29 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|