C25H29ClN4OS — CID 171716123
5-[4-(4-chlorophenyl)cyclohexyl]-3-[(4-phenylpiperazin-1-yl)methyl]-1,3,4-oxadiazole-2-thione (PubChem CID 171716123) has the molecular formula C25H29ClN4OS and a molecular weight of 469.05 g/mol. Its IUPAC name is 5-[4-(4-chlorophenyl)cyclohexyl]-3-[(4-phenylpiperazin-1-yl)methyl]-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-[4-(4-chlorophenyl)cyclohexyl]-3-[(4-phenylpiperazin-1-yl)methyl]-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 171716123 |
| Molecular Formula | C25H29ClN4OS |
| Molecular Weight | 469.05 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | 5-[4-(4-chlorophenyl)cyclohexyl]-3-[(4-phenylpiperazin-1-yl)methyl]-1,3,4-oxadiazole-2-thione |
| SMILES | S=c1oc(C2CCC(c3ccc(Cl)cc3)CC2)nn1CN1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C25H29ClN4OS/c26-22-12-10-20(11-13-22)19-6-8-21(9-7-19)24-27-30(25(32)31-24)18-28-14-16-29(17-15-28)23-4-2-1-3-5-23/h1-5,10-13,19,21H,6-9,14-18H2 |
| InChIKey | IJGKPNYYJDIHDL-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 37.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.05 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|