C19H19NO4 — CID 171716269
(4R,4aS,7aR,12bS)-4a,9-dihydroxy-3-propyl-7a,13-dihydro-4H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one (PubChem CID 171716269) has the molecular formula C19H19NO4 and a molecular weight of 325.36 g/mol. Its IUPAC name is (4R,4aS,7aR,12bS)-4a,9-dihydroxy-3-propyl-7a,13-dihydro-4H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one.
| Compound Name | (4R,4aS,7aR,12bS)-4a,9-dihydroxy-3-propyl-7a,13-dihydro-4H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one |
|---|---|
| PubChem CID | 171716269 |
| Molecular Formula | C19H19NO4 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | (4R,4aS,7aR,12bS)-4a,9-dihydroxy-3-propyl-7a,13-dihydro-4H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one |
| SMILES | CCCN1C=C[C@]23c4c5ccc(O)c4O[C@H]2C(=O)C=C[C@@]3(O)[C@H]1C5 |
| InChI | InChI=1S/C19H19NO4/c1-2-8-20-9-7-18-15-11-3-4-12(21)16(15)24-17(18)13(22)5-6-19(18,23)14(20)10-11/h3-7,9,14,17,21,23H,2,8,10H2,1H3/t14-,17+,18+,19-/m1/s1 |
| InChIKey | JPYSUBPXGDUQHZ-GRGSLBFTSA-N |
| XLogP | 1.42 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |